Products 1509909-35-6
CAS 1509909-35-6 is the registry number for 2-hydroxy-3-(methyl-d3)-Butanoic-2,3,4,4,4-d5 Acid. Offered by: TRC. Available pack sizes: 25mg.
(2S)-2,3,4,4,4-pentadeuterio-2-hydroxy-3-(trideuteriomethyl)butanoic acid (CAS 1509909-35-6) is a chemical compound with the molecular formula C5H10O3 and a molecular weight of 126.18 g/mol. IUPAC name: (2S)-2,3,4,4,4-pentadeuterio-2-hydroxy-3-(trideuteriomethyl)butanoic acid. InChIKey: NGEWQZIDQIYUNV-AYWPRJOCSA-N.
| Molecular formula | C5H10O3 |
|---|---|
| Molecular weight | 126.18 g/mol |
| IUPAC name | (2S)-2,3,4,4,4-pentadeuterio-2-hydroxy-3-(trideuteriomethyl)butanoic acid |
| InChIKey | NGEWQZIDQIYUNV-AYWPRJOCSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])O |
Computed by PubChem (NCBI)