CAS 1509929-23-0 appears in our catalog under these names: (4S,5R)-4,5-Diphenyl-2-(6-phenylpyridin-2-yl)-4,5-dihydrooxazole 98% 99%ee, (S,R)-6-Ph-Pyox-BisPh, 98% 99%ee, 98% 99%ee, (4S,5R)-4,5-Diphenyl-2-(6-phenylpyridin-2-yl)-4,5-dihydrooxazole, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 50mg.
(4S,5R)-4,5-diphenyl-2-(6-phenyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole (CAS 1509929-23-0) is a chemical compound with the molecular formula C26H20N2O and a molecular weight of 376.4 g/mol. IUPAC name: (4S,5R)-4,5-diphenyl-2-(6-phenyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole. InChIKey: GEGIOXAHQGYSFZ-LOSJGSFVSA-N.
| Molecular formula | C26H20N2O |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | (4S,5R)-4,5-diphenyl-2-(6-phenyl-2-pyridinyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | GEGIOXAHQGYSFZ-LOSJGSFVSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]2[C@H](OC(=N2)C3=CC=CC(=N3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)