CAS 1510554-64-9 is the registry number for 4-Chloro-2-(2,3-dichlorophenyl)aniline, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-2-(2,3-dichlorophenyl)aniline (CAS 1510554-64-9) is a chemical compound with the molecular formula C12H8Cl3N and a molecular weight of 272.6 g/mol. IUPAC name: 4-chloro-2-(2,3-dichlorophenyl)aniline. InChIKey: JDSOXBOZCODIED-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl3N |
|---|---|
| Molecular weight | 272.6 g/mol |
| IUPAC name | 4-chloro-2-(2,3-dichlorophenyl)aniline |
| InChIKey | JDSOXBOZCODIED-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=C(C=CC(=C2)Cl)N |
Computed by PubChem (NCBI)