CAS 1510692-71-3 appears in our catalog under these names: 2-Amino-4,4-dimethyl-4,5,6,7-tetrahydrobenzo(b)thiophene-3-carbonitrile, 98%, 2-Amino-4,4-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 50mg.
2-amino-4,4-dimethyl-6,7-dihydro-5H-1-benzothiophene-3-carbonitrile (CAS 1510692-71-3) is a chemical compound with the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. IUPAC name: 2-amino-4,4-dimethyl-6,7-dihydro-5H-1-benzothiophene-3-carbonitrile. InChIKey: RANGIXHAOGTFIH-UHFFFAOYSA-N.
| Molecular formula | C11H14N2S |
|---|---|
| Molecular weight | 206.31 g/mol |
| IUPAC name | 2-amino-4,4-dimethyl-6,7-dihydro-5H-1-benzothiophene-3-carbonitrile |
| InChIKey | RANGIXHAOGTFIH-UHFFFAOYSA-N |
| SMILES | CC1(CCCC2=C1C(=C(S2)N)C#N)C |
Computed by PubChem (NCBI)