CAS 15107-31-0 is the registry number for 4,4'-bis(dibromomethyl)-1,1'-biphenyl. Offered by: Chemat Brand. Available pack sizes: on request.
1-(dibromomethyl)-4-[4-(dibromomethyl)phenyl]benzene (CAS 15107-31-0) is a chemical compound with the molecular formula C14H10Br4 and a molecular weight of 497.8 g/mol. IUPAC name: 1-(dibromomethyl)-4-[4-(dibromomethyl)phenyl]benzene. InChIKey: KBMVICJDPYBLDW-UHFFFAOYSA-N.
| Molecular formula | C14H10Br4 |
|---|---|
| Molecular weight | 497.8 g/mol |
| IUPAC name | 1-(dibromomethyl)-4-[4-(dibromomethyl)phenyl]benzene |
| InChIKey | KBMVICJDPYBLDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)C(Br)Br)C(Br)Br |
Computed by PubChem (NCBI)