CAS 15108-19-7 appears in our catalog under these names: 2,2'-((Benzofuran-2,3-diylbis(azanylylidene))bis(methanylylidene))diphenol, 98%, Hydrocyansalide/ 98+%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 25g, 5g.
2-[[2-[(E)-(2-hydroxyphenyl)methylideneamino]-1-benzofuran-3-yl]iminomethyl]phenol (CAS 15108-19-7) is a chemical compound with the molecular formula C22H16N2O3 and a molecular weight of 356.4 g/mol. IUPAC name: 2-[[2-[(E)-(2-hydroxyphenyl)methylideneamino]-1-benzofuran-3-yl]iminomethyl]phenol. InChIKey: WBJRRXSNHBYISQ-TWPICZTKSA-N.
| Molecular formula | C22H16N2O3 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2-[[2-[(E)-(2-hydroxyphenyl)methylideneamino]-1-benzofuran-3-yl]iminomethyl]phenol |
| InChIKey | WBJRRXSNHBYISQ-TWPICZTKSA-N |
| SMILES | C1=CC=C(C(=C1)C=NC2=C(OC3=CC=CC=C32)/N=C/C4=CC=CC=C4O)O |
Computed by PubChem (NCBI)