Products 1510825-03-2
CAS 1510825-03-2 is the registry number for α-Synuclein inhibitor 9. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[[4-hydroxy-3-[(4-hydroxyphenyl)methyl]phenyl]methyl]-4-[(4-hydroxyphenyl)methyl]phenol (CAS 1510825-03-2) is a chemical compound with the molecular formula C27H24O4 and a molecular weight of 412.5 g/mol. IUPAC name: 2-[[4-hydroxy-3-[(4-hydroxyphenyl)methyl]phenyl]methyl]-4-[(4-hydroxyphenyl)methyl]phenol. InChIKey: WZFIJLNTQYXDQA-UHFFFAOYSA-N.
| Molecular formula | C27H24O4 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | 2-[[4-hydroxy-3-[(4-hydroxyphenyl)methyl]phenyl]methyl]-4-[(4-hydroxyphenyl)methyl]phenol |
| InChIKey | WZFIJLNTQYXDQA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=CC(=C(C=C2)O)CC3=CC(=C(C=C3)O)CC4=CC=C(C=C4)O)O |
Computed by PubChem (NCBI)