CAS 1510842-52-0 is the registry number for Boc-L-Ser(CF2H)-OH. Offered by: Iris Biotech. Available pack sizes: on request.
(2S)-3-(difluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1510842-52-0) is a chemical compound with the molecular formula C9H15F2NO5 and a molecular weight of 255.22 g/mol. IUPAC name: (2S)-3-(difluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ANCACCZYSBZZOT-YFKPBYRVSA-N.
| Molecular formula | C9H15F2NO5 |
|---|---|
| Molecular weight | 255.22 g/mol |
| IUPAC name | (2S)-3-(difluoromethoxy)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ANCACCZYSBZZOT-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COC(F)F)C(=O)O |
Computed by PubChem (NCBI)