CAS 1511327-10-8 is the registry number for 1-(5-chlorothiophen-2-yl)-4,4-dimethylcyclohexanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(5-chlorothiophen-2-yl)-4,4-dimethylcyclohexan-1-ol (CAS 1511327-10-8) is a chemical compound with the molecular formula C12H17ClOS and a molecular weight of 244.78 g/mol. IUPAC name: 1-(5-chlorothiophen-2-yl)-4,4-dimethylcyclohexan-1-ol. InChIKey: XPQNIYPXGKTUTA-UHFFFAOYSA-N.
| Molecular formula | C12H17ClOS |
|---|---|
| Molecular weight | 244.78 g/mol |
| IUPAC name | 1-(5-chlorothiophen-2-yl)-4,4-dimethylcyclohexan-1-ol |
| InChIKey | XPQNIYPXGKTUTA-UHFFFAOYSA-N |
| SMILES | CC1(CCC(CC1)(C2=CC=C(S2)Cl)O)C |
Computed by PubChem (NCBI)