CAS 151169-67-4 appears in our catalog under these names: 4-Chloro-3-nitrophenylboronic acid 98%, 3-Nitro-4-chlorophenylboronic acid, 98%, 4-Chloro-3-nitrophenylboronic acid, 98%, 98%, 4–Chloro–3–nitrobenzeneboronic acid(contains varying amounts of Anhydride), 4-Chloro-3-nitrophenylboronic Acid (contains varying amounts of Anhydride). Offered by: Ambeed, Fluorochem, Chemat, GLPBio, TCI. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
(4-chloro-3-nitrophenyl)boronic acid (CAS 151169-67-4) is a chemical compound with the molecular formula C6H5BClNO4 and a molecular weight of 201.37 g/mol. IUPAC name: (4-chloro-3-nitrophenyl)boronic acid. InChIKey: LQCCRPUZTXKDGB-UHFFFAOYSA-N.
| Molecular formula | C6H5BClNO4 |
|---|---|
| Molecular weight | 201.37 g/mol |
| IUPAC name | (4-chloro-3-nitrophenyl)boronic acid |
| InChIKey | LQCCRPUZTXKDGB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)