CAS 151223-12-0 appears in our catalog under these names: (S)-4-(2-Hydroxyethyl)-2,2-diisopropyl-1,3-dioxolane, 95%, (S)–4–(2–Hydroxyethyl)–2,2–diisopropyl–1,3–dioxolane, (S)-4-(2-Hydroxyethyl)-2,2-diisopropyl-1,3-dioxolane, >95.0%(GC), (S)-4-(2-Hydroxyethyl)-2,2-diisopropyl-1,3-dioxolane. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 200mg.
2-[(4S)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol (CAS 151223-12-0) is a chemical compound with the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. IUPAC name: 2-[(4S)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol. InChIKey: XFPZNMFFBDUEGH-JTQLQIEISA-N.
| Molecular formula | C11H22O3 |
|---|---|
| Molecular weight | 202.29 g/mol |
| IUPAC name | 2-[(4S)-2,2-di(propan-2-yl)-1,3-dioxolan-4-yl]ethanol |
| InChIKey | XFPZNMFFBDUEGH-JTQLQIEISA-N |
| SMILES | CC(C)C1(OC[C@@H](O1)CCO)C(C)C |
Computed by PubChem (NCBI)