CAS 151262-57-6 appears in our catalog under these names: Bicalutamide EP Impurity M, Bicalutamide Impurity 15(EP Impurity M), 3-((4-Fluorophenyl)sulfonyl)-2-hydroxy-2-methylpropanoic acid, 98%, 3-((4-Fluorophenyl)sulfonyl)-2-hydroxy-2-methylpropanoic Acid, >95% (HPLC), (2RS)-3-((4-Fluorophenyl)sulfonyl)-2-hydroxy-2-methylpropanoic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methylpropanoic acid (CAS 151262-57-6) is a chemical compound with the molecular formula C10H11FO5S and a molecular weight of 262.26 g/mol. IUPAC name: 3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methylpropanoic acid. InChIKey: DSXJLPDNNPNIRF-UHFFFAOYSA-N.
| Molecular formula | C10H11FO5S |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | 3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methylpropanoic acid |
| InChIKey | DSXJLPDNNPNIRF-UHFFFAOYSA-N |
| SMILES | CC(CS(=O)(=O)C1=CC=C(C=C1)F)(C(=O)O)O |
Computed by PubChem (NCBI)