Products 1512864-59-3
CAS 1512864-59-3 is the registry number for 5-Hydroxymethyl Tolterodine Succinate . Offered by: Chemat Brand. Available pack sizes: on request.
Butanedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol (CAS 1512864-59-3) is a chemical compound with the molecular formula C26H37NO6 and a molecular weight of 459.6 g/mol. IUPAC name: butanedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol. InChIKey: FRPJDSBXTGYKRS-VEIFNGETSA-N.
| Molecular formula | C26H37NO6 |
|---|---|
| Molecular weight | 459.6 g/mol |
| IUPAC name | butanedioic acid;2-[(1R)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol |
| InChIKey | FRPJDSBXTGYKRS-VEIFNGETSA-N |
| SMILES | CC(C)N(CC[C@H](C1=CC=CC=C1)C2=C(C=CC(=C2)CO)O)C(C)C.C(CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)