CAS 1512932-26-1 is the registry number for 4,4,4-Trifluoro-2-(4-fluorophenyl)butanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4,4,4-trifluoro-2-(4-fluorophenyl)butanoic acid (CAS 1512932-26-1) is a chemical compound with the molecular formula C10H8F4O2 and a molecular weight of 236.16 g/mol. IUPAC name: 4,4,4-trifluoro-2-(4-fluorophenyl)butanoic acid. InChIKey: VVYQURBTETUHHS-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | 4,4,4-trifluoro-2-(4-fluorophenyl)butanoic acid |
| InChIKey | VVYQURBTETUHHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CC(F)(F)F)C(=O)O)F |
Computed by PubChem (NCBI)