CAS 773102-32-2 appears in our catalog under these names: 2-(2-Fluoro-5-(trifluoromethyl)phenyl)-1,3-dioxolane, 97%, 2-(2-Fluoro-5-(trifluoromethyl)phenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-[2-fluoro-5-(trifluoromethyl)phenyl]-1,3-dioxolane (CAS 773102-32-2) is a chemical compound with the molecular formula C10H8F4O2 and a molecular weight of 236.16 g/mol. IUPAC name: 2-[2-fluoro-5-(trifluoromethyl)phenyl]-1,3-dioxolane. InChIKey: MGNGHBQBVJWIRG-UHFFFAOYSA-N.
| Molecular formula | C10H8F4O2 |
|---|---|
| Molecular weight | 236.16 g/mol |
| IUPAC name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]-1,3-dioxolane |
| InChIKey | MGNGHBQBVJWIRG-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)