Products 1512954-94-7
CAS 1512954-94-7 is the registry number for Ethyl 4-bromo-7-methylbenzo[b]thiophene-2-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 4-bromo-7-methyl-1-benzothiophene-2-carboxylate (CAS 1512954-94-7) is a chemical compound with the molecular formula C12H11BrO2S and a molecular weight of 299.19 g/mol. IUPAC name: ethyl 4-bromo-7-methyl-1-benzothiophene-2-carboxylate. InChIKey: UAYAEPKNWAFQGS-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO2S |
|---|---|
| Molecular weight | 299.19 g/mol |
| IUPAC name | ethyl 4-bromo-7-methyl-1-benzothiophene-2-carboxylate |
| InChIKey | UAYAEPKNWAFQGS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=CC(=C2S1)C)Br |
Computed by PubChem (NCBI)