Products 15136-06-8
CAS 15136-06-8 is the registry number for rel-(1R,2S)-2-Cyclopropylcyclopropane-1-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Cis-(1R,2S)-2-cyclopropylcyclopropane-1-carboxylic acid (CAS 15136-06-8) is a chemical compound with the molecular formula C7H10O2 and a molecular weight of 126.15 g/mol. IUPAC name: cis-(1R,2S)-2-cyclopropylcyclopropane-1-carboxylic acid. InChIKey: MZCSKKFXNXGUGR-NTSWFWBYSA-N.
| Molecular formula | C7H10O2 |
|---|---|
| Molecular weight | 126.15 g/mol |
| IUPAC name | cis-(1R,2S)-2-cyclopropylcyclopropane-1-carboxylic acid |
| InChIKey | MZCSKKFXNXGUGR-NTSWFWBYSA-N |
| SMILES | C1CC1[C@@H]2C[C@H]2C(=O)O |
Computed by PubChem (NCBI)