CAS 15136-26-2 appears in our catalog under these names: (S,S)-3-Isopropyl-6-methylpiperazine-2,5-dione, 98%, (3S,6S)-3-Isopropyl-6-methylpiperazine-2,5-dione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(3S,6S)-3-methyl-6-propan-2-ylpiperazine-2,5-dione (CAS 15136-26-2) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. IUPAC name: (3S,6S)-3-methyl-6-propan-2-ylpiperazine-2,5-dione. InChIKey: ORLDMMKUTCCBSM-WDSKDSINSA-N.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | (3S,6S)-3-methyl-6-propan-2-ylpiperazine-2,5-dione |
| InChIKey | ORLDMMKUTCCBSM-WDSKDSINSA-N |
| SMILES | C[C@H]1C(=O)N[C@H](C(=O)N1)C(C)C |
Computed by PubChem (NCBI)