CAS 151379-99-6 appears in our catalog under these names: 9-Octadecenoic acid (9Z)-, 1-[[(hydroxymethoxyphosphinyl)oxy]methyl]-1,2-ethanediyl ester, sodium salt, (R)-, 95%, 18:1 PHOSPHATIDYLMETHANOL, 18:1 Phosphatidylmethanol (sodium). Offered by: Chemat Brand, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 25MG, Get quote.
Sodium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] methyl phosphate (CAS 151379-99-6) is a chemical compound with the molecular formula C40H74NaO8P and a molecular weight of 737.0 g/mol. IUPAC name: sodium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] methyl phosphate. InChIKey: VZVXMZAFOPVENO-MDTXTNHHSA-M.
| Molecular formula | C40H74NaO8P |
|---|---|
| Molecular weight | 737.0 g/mol |
| IUPAC name | sodium [(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] methyl phosphate |
| InChIKey | VZVXMZAFOPVENO-MDTXTNHHSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OC)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Na+] |
Computed by PubChem (NCBI)