CAS 1513825-13-2 appears in our catalog under these names: 2-(2-Fluoro-4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 2-(2-Fluoro-4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-(2-fluoro-4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 1513825-13-2) is a chemical compound with the molecular formula C12H10FNO3S and a molecular weight of 267.28 g/mol. IUPAC name: 2-(2-fluoro-4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: PWFQHMKSZOAEBH-UHFFFAOYSA-N.
| Molecular formula | C12H10FNO3S |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 2-(2-fluoro-4-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | PWFQHMKSZOAEBH-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=C(C=C(C=C2)OC)F)C(=O)O |
Computed by PubChem (NCBI)