CAS 1513957-87-3 is the registry number for 2-(2,5-Diisopropylthiophen-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2,5-di(propan-2-yl)thiophen-3-yl]acetic acid (CAS 1513957-87-3) is a chemical compound with the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. IUPAC name: 2-[2,5-di(propan-2-yl)thiophen-3-yl]acetic acid. InChIKey: YOLGHUHVFWXNEV-UHFFFAOYSA-N.
| Molecular formula | C12H18O2S |
|---|---|
| Molecular weight | 226.34 g/mol |
| IUPAC name | 2-[2,5-di(propan-2-yl)thiophen-3-yl]acetic acid |
| InChIKey | YOLGHUHVFWXNEV-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(S1)C(C)C)CC(=O)O |
Computed by PubChem (NCBI)