CAS 151455-33-3 appears in our catalog under these names: Arbidol Impurity 3, Arbidol Sulfoxide, Arbidol Impurity 34, Arbidol Sulfoxide, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2mg.
Ethyl 2-(benzenesulfinylmethyl)-6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methylindole-3-carboxylate (CAS 151455-33-3) is a chemical compound with the molecular formula C22H25BrN2O4S and a molecular weight of 493.4 g/mol. IUPAC name: ethyl 2-(benzenesulfinylmethyl)-6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methylindole-3-carboxylate. InChIKey: CTIGWEMWZSPYAS-UHFFFAOYSA-N.
| Molecular formula | C22H25BrN2O4S |
|---|---|
| Molecular weight | 493.4 g/mol |
| IUPAC name | ethyl 2-(benzenesulfinylmethyl)-6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methylindole-3-carboxylate |
| InChIKey | CTIGWEMWZSPYAS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C2=CC(=C(C(=C21)CN(C)C)O)Br)C)CS(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)