Products 1514610-57-1
CAS 1514610-57-1 is the registry number for 1-(4-Fluorophenyl)-3,3-dimethylpiperazin-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-fluorophenyl)-3,3-dimethylpiperazin-2-one (CAS 1514610-57-1) is a chemical compound with the molecular formula C12H15FN2O and a molecular weight of 222.26 g/mol. IUPAC name: 1-(4-fluorophenyl)-3,3-dimethylpiperazin-2-one. InChIKey: CLLYMBGVWOUTQJ-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O |
|---|---|
| Molecular weight | 222.26 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-3,3-dimethylpiperazin-2-one |
| InChIKey | CLLYMBGVWOUTQJ-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(CCN1)C2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)