CAS 1514888-56-2 appears in our catalog under these names: S1p receptor agonist 1/ 99.9%, S1p receptor agonist 1, 1-(2-Fluoro-4-(5-(4-isobutylphenyl)-1,2,4-oxadiazol-3-yl)benzyl)azetidine-3-carboxylic acid, 98%, 98%, Icanbelimod, 99.90%, Icanbelimod (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
1-[[2-fluoro-4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid (CAS 1514888-56-2) is a chemical compound with the molecular formula C23H24FN3O3 and a molecular weight of 409.5 g/mol. IUPAC name: 1-[[2-fluoro-4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid. InChIKey: YBIFMTGYWXNIRZ-UHFFFAOYSA-N.
| Molecular formula | C23H24FN3O3 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 1-[[2-fluoro-4-[5-[4-(2-methylpropyl)phenyl]-1,2,4-oxadiazol-3-yl]phenyl]methyl]azetidine-3-carboxylic acid |
| InChIKey | YBIFMTGYWXNIRZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=CC=C(C=C1)C2=NC(=NO2)C3=CC(=C(C=C3)CN4CC(C4)C(=O)O)F |
Computed by PubChem (NCBI)