Products 1515348-08-9

CAS 1515348-08-9 is the registry number for tert-Butyl 3,10-diazabicyclo(4.3.1)decane-10-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3,10-diazabicyclo[4.3.1]decane-10-carboxylate (CAS 1515348-08-9) is a chemical compound with the molecular formula C13H24N2O2 and a molecular weight of 240.34 g/mol. IUPAC name: tert-butyl 3,10-diazabicyclo[4.3.1]decane-10-carboxylate. InChIKey: LIGAGWJQAVPQAE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24N2O2
Molecular weight240.34 g/mol
IUPAC nametert-butyl 3,10-diazabicyclo[4.3.1]decane-10-carboxylate
InChIKeyLIGAGWJQAVPQAE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C2CCCC1CNCC2

Computed by PubChem (NCBI)