Products 1515851-05-4

CAS 1515851-05-4 is the registry number for 2-(5-Azaspiro[2.3]hexan-5-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(5-azaspiro[2.3]hexan-5-yl)acetic acid (CAS 1515851-05-4) is a chemical compound with the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. IUPAC name: 2-(5-azaspiro[2.3]hexan-5-yl)acetic acid. InChIKey: WDJJLYDPYXYVAV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11NO2
Molecular weight141.17 g/mol
IUPAC name2-(5-azaspiro[2.3]hexan-5-yl)acetic acid
InChIKeyWDJJLYDPYXYVAV-UHFFFAOYSA-N
SMILESC1CC12CN(C2)CC(=O)O

Computed by PubChem (NCBI)