CAS 1515883-78-9 is the registry number for 2-Chloro-8-fluoro-6,7-dimethoxyquinazolin-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
2-chloro-8-fluoro-6,7-dimethoxyquinazolin-4-amine (CAS 1515883-78-9) is a chemical compound with the molecular formula C10H9ClFN3O2 and a molecular weight of 257.65 g/mol. IUPAC name: 2-chloro-8-fluoro-6,7-dimethoxyquinazolin-4-amine. InChIKey: WDQUKTUBTHMHGM-UHFFFAOYSA-N.
| Molecular formula | C10H9ClFN3O2 |
|---|---|
| Molecular weight | 257.65 g/mol |
| IUPAC name | 2-chloro-8-fluoro-6,7-dimethoxyquinazolin-4-amine |
| InChIKey | WDQUKTUBTHMHGM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)C(=NC(=N2)Cl)N)F)OC |
Computed by PubChem (NCBI)