CAS 1516-94-5 is the registry number for 4,4'-(Ethane-1,2-diyl)bis(2,6-di-tert-butylphenol), 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenol (CAS 1516-94-5) is a chemical compound with the molecular formula C30H46O2 and a molecular weight of 438.7 g/mol. IUPAC name: 2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenol. InChIKey: LRRMGPGVHYPBPL-UHFFFAOYSA-N.
| Molecular formula | C30H46O2 |
|---|---|
| Molecular weight | 438.7 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethyl]phenol |
| InChIKey | LRRMGPGVHYPBPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC2=CC(=C(C(=C2)C(C)(C)C)O)C(C)(C)C |
Computed by PubChem (NCBI)