CAS 15165-79-4 appears in our catalog under these names: 1-Naphthaleneacetic acid potassium salt, 98%, 1-Naphthaleneacetic acid potassium salt/ 97.52% (existing batch purity), Potassium 1–Naphthaleneacetate, Potassium 1-Naphthaleneacetate, >99.0%(T), 1-Naphthaleneacetic acid potassium salt, 95.00%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 100g, 5g, 25g, 1g, 50mg, 100mg, 200mg, 500mg.
Potassium 2-naphthalen-1-ylacetate (CAS 15165-79-4) is a chemical compound with the molecular formula C12H9KO2 and a molecular weight of 224.30 g/mol. IUPAC name: potassium 2-naphthalen-1-ylacetate. InChIKey: HPQBUYIHTJNBOM-UHFFFAOYSA-M.
| Molecular formula | C12H9KO2 |
|---|---|
| Molecular weight | 224.30 g/mol |
| IUPAC name | potassium 2-naphthalen-1-ylacetate |
| InChIKey | HPQBUYIHTJNBOM-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)