Products 1516627-62-5
CAS 1516627-62-5 is the registry number for 2-Oxo-6-(propan-2-yl)piperidine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-oxo-6-propan-2-ylpiperidine-3-carboxylic acid (CAS 1516627-62-5) is a chemical compound with the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. IUPAC name: 2-oxo-6-propan-2-ylpiperidine-3-carboxylic acid. InChIKey: QXFGYIHWNBEEGG-UHFFFAOYSA-N.
| Molecular formula | C9H15NO3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 2-oxo-6-propan-2-ylpiperidine-3-carboxylic acid |
| InChIKey | QXFGYIHWNBEEGG-UHFFFAOYSA-N |
| SMILES | CC(C)C1CCC(C(=O)N1)C(=O)O |
Computed by PubChem (NCBI)