Products 1516702-40-1
CAS 1516702-40-1 is the registry number for N-cyclopropyl-2-fluoro-5-(trifluoromethyl)benzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
N-cyclopropyl-2-fluoro-5-(trifluoromethyl)benzamide (CAS 1516702-40-1) is a chemical compound with the molecular formula C11H9F4NO and a molecular weight of 247.19 g/mol. IUPAC name: N-cyclopropyl-2-fluoro-5-(trifluoromethyl)benzamide. InChIKey: NGQPCLIVIWEDJP-UHFFFAOYSA-N.
| Molecular formula | C11H9F4NO |
|---|---|
| Molecular weight | 247.19 g/mol |
| IUPAC name | N-cyclopropyl-2-fluoro-5-(trifluoromethyl)benzamide |
| InChIKey | NGQPCLIVIWEDJP-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=C(C=CC(=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)