CAS 15170-57-7 appears in our catalog under these names: Platinum acetylacetonate, Platinum(II) acetylacetonate, Platinum 2,4-pentanedionate, Platinum(II) acetylacetonate, 98%, Bis(2,4-pentanedionato)platinum(II). Offered by: GLPBio, Chemat, Thermo Scientific (Acros), TCI, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 250mg, 5g, 25g, 100mg, 500MG.
Bis((Z)-4-hydroxypent-3-en-2-one);platinum (CAS 15170-57-7) is a chemical compound with the molecular formula C10H16O4Pt and a molecular weight of 395.32 g/mol. IUPAC name: bis((Z)-4-hydroxypent-3-en-2-one);platinum. InChIKey: VEJOYRPGKZZTJW-FDGPNNRMSA-N.
| Molecular formula | C10H16O4Pt |
|---|---|
| Molecular weight | 395.32 g/mol |
| IUPAC name | bis((Z)-4-hydroxypent-3-en-2-one);platinum |
| InChIKey | VEJOYRPGKZZTJW-FDGPNNRMSA-N |
| SMILES | C/C(=C/C(=O)C)/O.C/C(=C/C(=O)C)/O.[Pt] |
Computed by PubChem (NCBI)