CAS 15170-74-8 appears in our catalog under these names: (1–carboxy–3–methylsulfanylpropyl)azanide, Copper methionine Cu≥15%, Copper methionine, Cu≥15%, Cu≥15%. Offered by: GLPBio, Ambeed, Chemat. Available pack sizes: 100g, 25g, 500g, 5g, 1g.
Copper bis((1-carboxy-3-methylsulfanylpropyl)azanide) (CAS 15170-74-8) is a chemical compound with the molecular formula C10H20CuN2O4S2 and a molecular weight of 360.0 g/mol. IUPAC name: copper bis((1-carboxy-3-methylsulfanylpropyl)azanide). InChIKey: OGKRAMHEYIKPDE-UHFFFAOYSA-N.
| Molecular formula | C10H20CuN2O4S2 |
|---|---|
| Molecular weight | 360.0 g/mol |
| IUPAC name | copper bis((1-carboxy-3-methylsulfanylpropyl)azanide) |
| InChIKey | OGKRAMHEYIKPDE-UHFFFAOYSA-N |
| SMILES | CSCCC(C(=O)O)[NH-].CSCCC(C(=O)O)[NH-].[Cu+2] |
Computed by PubChem (NCBI)