CAS 151721-78-7 appears in our catalog under these names: 1,3,5-Tribromo-2,4,6-triiodobenzene, 95%, 95%, 1,3,5-Tribromo-2,4,6-triiodobenzene, 98%, 1,3,5-Tribromo-2,4,6-triiodobenzene, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1,3,5-tribromo-2,4,6-triiodobenzene (CAS 151721-78-7) is a chemical compound with the molecular formula C6Br3I3 and a molecular weight of 692.49 g/mol. IUPAC name: 1,3,5-tribromo-2,4,6-triiodobenzene. InChIKey: PHXNXSOHPKDBSW-UHFFFAOYSA-N.
| Molecular formula | C6Br3I3 |
|---|---|
| Molecular weight | 692.49 g/mol |
| IUPAC name | 1,3,5-tribromo-2,4,6-triiodobenzene |
| InChIKey | PHXNXSOHPKDBSW-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1I)Br)I)Br)I)Br |
Computed by PubChem (NCBI)