CAS 151722-06-4 is the registry number for N-Acetylemtricitabine. Offered by: Chemat Brand. Available pack sizes: on request.
N-[5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide (CAS 151722-06-4) is a chemical compound with the molecular formula C10H12FN3O4S and a molecular weight of 289.29 g/mol. IUPAC name: N-[5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide. InChIKey: WKCMPPOKGOSEMH-JGVFFNPUSA-N.
| Molecular formula | C10H12FN3O4S |
|---|---|
| Molecular weight | 289.29 g/mol |
| IUPAC name | N-[5-fluoro-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2-oxopyrimidin-4-yl]acetamide |
| InChIKey | WKCMPPOKGOSEMH-JGVFFNPUSA-N |
| SMILES | CC(=O)NC1=NC(=O)N(C=C1F)[C@@H]2CS[C@@H](O2)CO |
Computed by PubChem (NCBI)