CAS 151736-00-4 is the registry number for Methyl 6-[[(4-methylphenyl)sulfonyl]oxy]-2-naphthalenecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Methyl 6-(4-methylphenyl)sulfonyloxynaphthalene-2-carboxylate (CAS 151736-00-4) is a chemical compound with the molecular formula C19H16O5S and a molecular weight of 356.4 g/mol. IUPAC name: methyl 6-(4-methylphenyl)sulfonyloxynaphthalene-2-carboxylate. InChIKey: KZLJGMNYKPEGQB-UHFFFAOYSA-N.
| Molecular formula | C19H16O5S |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | methyl 6-(4-methylphenyl)sulfonyloxynaphthalene-2-carboxylate |
| InChIKey | KZLJGMNYKPEGQB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2=CC3=C(C=C2)C=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)