CAS 151746-37-1 is the registry number for Bbta, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
2-[5-(6-amino-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazol-6-amine (CAS 151746-37-1) is a chemical compound with the molecular formula C18H12N4O2S and a molecular weight of 348.4 g/mol. IUPAC name: 2-[5-(6-amino-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazol-6-amine. InChIKey: UIYMRJVMMDFNSM-UHFFFAOYSA-N.
| Molecular formula | C18H12N4O2S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2-[5-(6-amino-1,3-benzoxazol-2-yl)thiophen-2-yl]-1,3-benzoxazol-6-amine |
| InChIKey | UIYMRJVMMDFNSM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)OC(=N2)C3=CC=C(S3)C4=NC5=C(O4)C=C(C=C5)N |
Computed by PubChem (NCBI)