CAS 1517999-55-1 is the registry number for 3-(4-Iodo-phenoxy)-2,2-dimethyl-propionic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(4-iodophenoxy)-2,2-dimethylpropanoic acid (CAS 1517999-55-1) is a chemical compound with the molecular formula C11H13IO3 and a molecular weight of 320.12 g/mol. IUPAC name: 3-(4-iodophenoxy)-2,2-dimethylpropanoic acid. InChIKey: AATSOTPFFIBYBL-UHFFFAOYSA-N.
| Molecular formula | C11H13IO3 |
|---|---|
| Molecular weight | 320.12 g/mol |
| IUPAC name | 3-(4-iodophenoxy)-2,2-dimethylpropanoic acid |
| InChIKey | AATSOTPFFIBYBL-UHFFFAOYSA-N |
| SMILES | CC(C)(COC1=CC=C(C=C1)I)C(=O)O |
Computed by PubChem (NCBI)