CAS 15182-81-7 is the registry number for 7-(Methylthio)-2H-benzo[b][1,4]thiazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methylsulfanyl-4H-1,4-benzothiazin-3-one (CAS 15182-81-7) is a chemical compound with the molecular formula C9H9NOS2 and a molecular weight of 211.3 g/mol. IUPAC name: 7-methylsulfanyl-4H-1,4-benzothiazin-3-one. InChIKey: RKIDHVSLPIJZCR-UHFFFAOYSA-N.
| Molecular formula | C9H9NOS2 |
|---|---|
| Molecular weight | 211.3 g/mol |
| IUPAC name | 7-methylsulfanyl-4H-1,4-benzothiazin-3-one |
| InChIKey | RKIDHVSLPIJZCR-UHFFFAOYSA-N |
| SMILES | CSC1=CC2=C(C=C1)NC(=O)CS2 |
Computed by PubChem (NCBI)