CAS 15183-28-5 appears in our catalog under these names: For-Met-Ala-OH, Formyl-L-methionyl-L-alanine, 97%, For–Met–Ala–OH. Offered by: Creative Peptides, AmBeed, GLPBio, Biosynth. Available pack sizes: on request, 1g, 250mg, 2000mg, 1000mg, 5000mg.
(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoic acid (CAS 15183-28-5) is a chemical compound with the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. IUPAC name: (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoic acid. InChIKey: GBWVAAKKEIOROG-BQBZGAKWSA-N.
| Molecular formula | C9H16N2O4S |
|---|---|
| Molecular weight | 248.30 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoic acid |
| InChIKey | GBWVAAKKEIOROG-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CCSC)NC=O |
Computed by PubChem (NCBI)