CAS 15183-75-2 appears in our catalog under these names: 2-Nitro-4-((trifluoromethyl)sulphonyl)phenol, 2-Nitro-4-[(trifluoromethyl)sulphonyl]phenol, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 0,1g, 250mg.
2-nitro-4-(trifluoromethylsulfonyl)phenol (CAS 15183-75-2) is a chemical compound with the molecular formula C7H4F3NO5S and a molecular weight of 271.17 g/mol. IUPAC name: 2-nitro-4-(trifluoromethylsulfonyl)phenol. InChIKey: YIKCQUUQMXHEEU-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO5S |
|---|---|
| Molecular weight | 271.17 g/mol |
| IUPAC name | 2-nitro-4-(trifluoromethylsulfonyl)phenol |
| InChIKey | YIKCQUUQMXHEEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)C(F)(F)F)[N+](=O)[O-])O |
Computed by PubChem (NCBI)