CAS 15185-59-8 appears in our catalog under these names: 3-Bromocinnamaldehyde, 95%, 3-(3-Bromophenyl)acrylaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.
(E)-3-(3-bromophenyl)prop-2-enal (CAS 15185-59-8) is a chemical compound with the molecular formula C9H7BrO and a molecular weight of 211.05 g/mol. IUPAC name: (E)-3-(3-bromophenyl)prop-2-enal. InChIKey: QICJGJJHIQBWJR-DUXPYHPUSA-N.
| Molecular formula | C9H7BrO |
|---|---|
| Molecular weight | 211.05 g/mol |
| IUPAC name | (E)-3-(3-bromophenyl)prop-2-enal |
| InChIKey | QICJGJJHIQBWJR-DUXPYHPUSA-N |
| SMILES | C1=CC(=CC(=C1)Br)/C=C/C=O |
Computed by PubChem (NCBI)