Products 151869-73-7

CAS 151869-73-7 is the registry number for 3,3-BIS(DIETHOXYPHOSPHORYL)PROPANOIC ACID, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3,3-bis(diethoxyphosphoryl)propanoic acid (CAS 151869-73-7) is a chemical compound with the molecular formula C11H24O8P2 and a molecular weight of 346.25 g/mol. IUPAC name: 3,3-bis(diethoxyphosphoryl)propanoic acid. InChIKey: GDQZCDGSLKIQJU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H24O8P2
Molecular weight346.25 g/mol
IUPAC name3,3-bis(diethoxyphosphoryl)propanoic acid
InChIKeyGDQZCDGSLKIQJU-UHFFFAOYSA-N
SMILESCCOP(=O)(C(CC(=O)O)P(=O)(OCC)OCC)OCC

Computed by PubChem (NCBI)