CAS 1518840-07-7 is the registry number for (4-Chloropyridin-2-yl)methanesulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(4-chloro-2-pyridinyl)methanesulfonamide (CAS 1518840-07-7) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: (4-chloro-2-pyridinyl)methanesulfonamide. InChIKey: BNLHYRPROKCOOM-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | (4-chloro-2-pyridinyl)methanesulfonamide |
| InChIKey | BNLHYRPROKCOOM-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)CS(=O)(=O)N |
Computed by PubChem (NCBI)