Products 151887-72-8
CAS 151887-72-8 is the registry number for Methyl 2-cyano-3-(4-methoxyphenyl)prop-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl (Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate (CAS 151887-72-8) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: methyl (Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate. InChIKey: MCFCPVVFVXSZSK-YFHOEESVSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | methyl (Z)-2-cyano-3-(4-methoxyphenyl)prop-2-enoate |
| InChIKey | MCFCPVVFVXSZSK-YFHOEESVSA-N |
| SMILES | COC1=CC=C(C=C1)/C=C(/C#N)\C(=O)OC |
Computed by PubChem (NCBI)