CAS 1519-45-5 appears in our catalog under these names: Ethylenebis(triphenylphosphonium bromide), Ethane-1,2-diylbis(triphenylphosphonium) bromide, 98%, 98%, Ethane-1,2-diylbis(triphenylphosphonium) bromide, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 25g, 5g, 100g.
Triphenyl(2-triphenylphosphaniumylethyl)phosphanium dibromide (CAS 1519-45-5) is a chemical compound with the molecular formula C38H34Br2P2 and a molecular weight of 712.4 g/mol. IUPAC name: triphenyl(2-triphenylphosphaniumylethyl)phosphanium dibromide. InChIKey: VRKRIHCAYUNAPF-UHFFFAOYSA-L.
| Molecular formula | C38H34Br2P2 |
|---|---|
| Molecular weight | 712.4 g/mol |
| IUPAC name | triphenyl(2-triphenylphosphaniumylethyl)phosphanium dibromide |
| InChIKey | VRKRIHCAYUNAPF-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)[P+](CC[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6.[Br-].[Br-] |
Computed by PubChem (NCBI)