CAS 1519337-88-2 is the registry number for 2,2,2-Trifluoro-1-(2-fluoro-6-methoxyphenyl)ethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(2-fluoro-6-methoxyphenyl)ethanol (CAS 1519337-88-2) is a chemical compound with the molecular formula C9H8F4O2 and a molecular weight of 224.15 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluoro-6-methoxyphenyl)ethanol. InChIKey: PJCOTFDJDCLVEU-UHFFFAOYSA-N.
| Molecular formula | C9H8F4O2 |
|---|---|
| Molecular weight | 224.15 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluoro-6-methoxyphenyl)ethanol |
| InChIKey | PJCOTFDJDCLVEU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)F)C(C(F)(F)F)O |
Computed by PubChem (NCBI)