Products 1519402-71-1
CAS 1519402-71-1 is the registry number for 3-(2-(Chloromethyl)-1H-imidazo[4,5-c]pyridin-1-yl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]thiane 1,1-dioxide (CAS 1519402-71-1) is a chemical compound with the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. IUPAC name: 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]thiane 1,1-dioxide. InChIKey: OWFPCNRGRJFNNY-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2S |
|---|---|
| Molecular weight | 299.78 g/mol |
| IUPAC name | 3-[2-(chloromethyl)imidazo[4,5-c]pyridin-1-yl]thiane 1,1-dioxide |
| InChIKey | OWFPCNRGRJFNNY-UHFFFAOYSA-N |
| SMILES | C1CC(CS(=O)(=O)C1)N2C3=C(C=NC=C3)N=C2CCl |
Computed by PubChem (NCBI)