Products 647825-52-3
CAS 647825-52-3 is the registry number for N-Benzyl-5-chloro-1,3-dimethyl-1H-pyrazole-4-sulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-benzyl-5-chloro-1,3-dimethylpyrazole-4-sulfonamide (CAS 647825-52-3) is a chemical compound with the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. IUPAC name: N-benzyl-5-chloro-1,3-dimethylpyrazole-4-sulfonamide. InChIKey: JBUDMWYFGVXLHI-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN3O2S |
|---|---|
| Molecular weight | 299.78 g/mol |
| IUPAC name | N-benzyl-5-chloro-1,3-dimethylpyrazole-4-sulfonamide |
| InChIKey | JBUDMWYFGVXLHI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1S(=O)(=O)NCC2=CC=CC=C2)Cl)C |
Computed by PubChem (NCBI)