Products 1519526-49-8

CAS 1519526-49-8 is the registry number for Methyl 2-methyl-3-oxoheptanoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-methyl-3-oxoheptanoate (CAS 1519526-49-8) is a chemical compound with the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. IUPAC name: methyl 2-methyl-3-oxoheptanoate. InChIKey: PMYHSLZZCNJJOC-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O3
Molecular weight172.22 g/mol
IUPAC namemethyl 2-methyl-3-oxoheptanoate
InChIKeyPMYHSLZZCNJJOC-UHFFFAOYSA-N
SMILESCCCCC(=O)C(C)C(=O)OC

Computed by PubChem (NCBI)